C32H36N2O3SSi — CID 173367524
1-tert-butyl-3-dimethylsilyl-3-[hydroxy(1,2-oxazol-3-yl)methyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 173367524) has the molecular formula C32H36N2O3SSi and a molecular weight of 556.80 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(1,2-oxazol-3-yl)methyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(1,2-oxazol-3-yl)methyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173367524 |
| Molecular Formula | C32H36N2O3SSi |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(1,2-oxazol-3-yl)methyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | C[SiH](C)C1(C(O)c2ccon2)C(=O)N(C(C)(C)C)C1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H36N2O3SSi/c1-30(2,3)34-28(36)32(39(4)5,27(35)26-21-22-37-33-26)29(34)38-31(23-15-9-6-10-16-23,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-22,27,29,35,39H,1-5H3 |
| InChIKey | DOBISDBFXVHZJC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|