C16H24N2O2Si — CID 173401996
6-tert-butyl-1-dimethylsilyl-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]heptan-7-one (PubChem CID 173401996) has the molecular formula C16H24N2O2Si and a molecular weight of 304.47 g/mol. Its IUPAC name is 6-tert-butyl-1-dimethylsilyl-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]heptan-7-one.
| Compound Name | 6-tert-butyl-1-dimethylsilyl-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 173401996 |
| Molecular Formula | C16H24N2O2Si |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 6-tert-butyl-1-dimethylsilyl-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]heptan-7-one |
| SMILES | C[SiH](C)C12NC(c3ccccc3)OC1N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C16H24N2O2Si/c1-15(2,3)18-13(19)16(21(4)5)14(18)20-12(17-16)11-9-7-6-8-10-11/h6-10,12,14,17,21H,1-5H3 |
| InChIKey | YEJLHAHEOCJUHA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|