C10H8Cl3NO2 — CID 95561028
(2R,5S)-2-phenyl-5-(trichloromethyl)-1,3-oxazolidin-4-one (PubChem CID 95561028) has the molecular formula C10H8Cl3NO2 and a molecular weight of 280.54 g/mol. Its IUPAC name is (2R,5S)-2-phenyl-5-(trichloromethyl)-1,3-oxazolidin-4-one.
| Compound Name | (2R,5S)-2-phenyl-5-(trichloromethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 95561028 |
| Molecular Formula | C10H8Cl3NO2 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | (2R,5S)-2-phenyl-5-(trichloromethyl)-1,3-oxazolidin-4-one |
| SMILES | O=C1N[C@@H](c2ccccc2)O[C@@H]1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8Cl3NO2/c11-10(12,13)7-8(15)14-9(16-7)6-4-2-1-3-5-6/h1-5,7,9H,(H,14,15)/t7-,9+/m0/s1 |
| InChIKey | PDYMIJXOWSDEJC-IONNQARKSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|