About 3-phenyloxaziridine
3-phenyloxaziridine (PubChem CID 18523120) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 3-phenyloxaziridine.
Molecular Properties
| Compound Name | 3-phenyloxaziridine |
| PubChem CID | 18523120 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 3-phenyloxaziridine |
| SMILES | c1ccc(C2NO2)cc1 |
| InChI | InChI=1S/C7H7NO/c1-2-4-6(5-3-1)7-8-9-7/h1-5,7-8H |
| InChIKey | NIFWBIZUAZVUMO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 34.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyloxaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyloxaziridine?
The IUPAC name of 3-phenyloxaziridine (CID 18523120) is 3-phenyloxaziridine.
What is the SMILES notation for 3-phenyloxaziridine?
The canonical SMILES for 3-phenyloxaziridine is c1ccc(C2NO2)cc1.
What is the InChIKey of 3-phenyloxaziridine?
The InChIKey is NIFWBIZUAZVUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-2-4-6(5-3-1)7-8-9-7/h1-5,7-8H.
What are the key properties of 3-phenyloxaziridine?
3-phenyloxaziridine has a molecular weight of 121.14 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyloxaziridine is sourced from PubChem (CID 18523120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).