C10H11NOS — CID 141379634
2-phenyl-1,3-oxazolidine-4-carbothialdehyde (PubChem CID 141379634) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-phenyl-1,3-oxazolidine-4-carbothialdehyde.
| Compound Name | 2-phenyl-1,3-oxazolidine-4-carbothialdehyde |
|---|---|
| PubChem CID | 141379634 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-phenyl-1,3-oxazolidine-4-carbothialdehyde |
| SMILES | S=CC1COC(c2ccccc2)N1 |
| InChI | InChI=1S/C10H11NOS/c13-7-9-6-12-10(11-9)8-4-2-1-3-5-8/h1-5,7,9-11H,6H2 |
| InChIKey | VXJDAWAHYMZRKN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|