C16H16ClNO2 — CID 100914739
[(2R,4S)-2-(4-chlorophenyl)-1,3-oxazolidin-4-yl]-phenylmethanol (PubChem CID 100914739) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is [(2R,4S)-2-(4-chlorophenyl)-1,3-oxazolidin-4-yl]-phenylmethanol.
| Compound Name | [(2R,4S)-2-(4-chlorophenyl)-1,3-oxazolidin-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 100914739 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [(2R,4S)-2-(4-chlorophenyl)-1,3-oxazolidin-4-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)[C@@H]1CO[C@H](c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C16H16ClNO2/c17-13-8-6-12(7-9-13)16-18-14(10-20-16)15(19)11-4-2-1-3-5-11/h1-9,14-16,18-19H,10H2/t14-,15?,16+/m0/s1 |
| InChIKey | COZGXXSAEWUXQZ-DLDKDUQYSA-N |
| XLogP | 3.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |