About phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol
phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol (PubChem CID 102280064) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol.
Molecular Properties
| Compound Name | phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol |
| PubChem CID | 102280064 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol |
| SMILES | OC(c1ccccc1)[C@H]1CC[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C18H20O2/c19-18(15-9-5-2-6-10-15)17-12-11-16(13-20-17)14-7-3-1-4-8-14/h1-10,16-19H,11-13H2/t16-,17+,18?/m0/s1 |
| InChIKey | LKDKWRYMMGOLNK-MYFVLZFPSA-N |
| XLogP | 3.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol?
The IUPAC name of phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol (CID 102280064) is phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol.
What is the SMILES notation for phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol?
The canonical SMILES for phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol is OC(c1ccccc1)[C@H]1CC[C@H](c2ccccc2)CO1.
What is the InChIKey of phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol?
The InChIKey is LKDKWRYMMGOLNK-MYFVLZFPSA-N. The full InChI is InChI=1S/C18H20O2/c19-18(15-9-5-2-6-10-15)17-12-11-16(13-20-17)14-7-3-1-4-8-14/h1-10,16-19H,11-13H2/t16-,17+,18?/m0/s1.
What are the key properties of phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol?
phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol has a molecular weight of 268.36 g/mol, XLogP of 3.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[(2R,5R)-5-phenyloxan-2-yl]methanol is sourced from PubChem (CID 102280064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).