C13H14O4 — CID 10561656
(R)-phenyl-[(1R,5S,6R)-3,7,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]methanol (PubChem CID 10561656) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (R)-phenyl-[(1R,5S,6R)-3,7,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]methanol.
| Compound Name | (R)-phenyl-[(1R,5S,6R)-3,7,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]methanol |
|---|---|
| PubChem CID | 10561656 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (R)-phenyl-[(1R,5S,6R)-3,7,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]methanol |
| SMILES | O[C@@H](c1ccccc1)[C@H]1C2OC2[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H14O4/c14-10(7-4-2-1-3-5-7)9-12-11(17-12)8-6-15-13(9)16-8/h1-5,8-14H,6H2/t8-,9+,10+,11?,12?,13-/m1/s1 |
| InChIKey | CRNLWZRXRNJXHZ-STJKIXCVSA-N |
| XLogP | 0.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|