C13H13N3O4 — CID 23232167
(1S,2S,4S,5R,6R)-5-[azido(phenyl)methoxy]-3,8,9-trioxatricyclo[4.2.1.02,4]nonane (PubChem CID 23232167) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is (1S,2S,4S,5R,6R)-5-[azido(phenyl)methoxy]-3,8,9-trioxatricyclo[4.2.1.02,4]nonane.
| Compound Name | (1S,2S,4S,5R,6R)-5-[azido(phenyl)methoxy]-3,8,9-trioxatricyclo[4.2.1.02,4]nonane |
|---|---|
| PubChem CID | 23232167 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (1S,2S,4S,5R,6R)-5-[azido(phenyl)methoxy]-3,8,9-trioxatricyclo[4.2.1.02,4]nonane |
| SMILES | [N-]=[N+]=NC(O[C@H]1[C@@H]2O[C@@H]2[C@H]2OC[C@H]1O2)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O4/c14-16-15-12(7-4-2-1-3-5-7)20-9-8-6-17-13(18-8)11-10(9)19-11/h1-5,8-13H,6H2/t8-,9-,10+,11+,12?,13+/m1/s1 |
| InChIKey | VFSGZMKHUCDVAD-UVHXYFFBSA-N |
| XLogP | 1.90 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|