C26H30O9 — CID 122360912
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(phenylmethoxy)-6-[[(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxan-3-ol (PubChem CID 122360912) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(phenylmethoxy)-6-[[(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(phenylmethoxy)-6-[[(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxan-3-ol |
|---|---|
| PubChem CID | 122360912 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-4,5-bis(phenylmethoxy)-6-[[(1R,2S,4S,5R,6R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxan-3-ol |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H]3O[C@@H]3[C@@H]3OC[C@H]2O3)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C26H30O9/c27-11-17-19(28)21(29-12-15-7-3-1-4-8-15)23(30-13-16-9-5-2-6-10-16)26(32-17)35-20-18-14-31-25(33-18)24-22(20)34-24/h1-10,17-28H,11-14H2/t17-,18-,19-,20-,21+,22+,23-,24+,25-,26+/m1/s1 |
| InChIKey | KZPKDLAMVCCZCS-CHDGIDJFSA-N |
| XLogP | 1.14 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|