C12H18O9 — CID 147292670
(3S,6S)-2-(hydroxymethyl)-6-[[(1R,4R,5R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxane-3,4,5-triol (PubChem CID 147292670) has the molecular formula C12H18O9 and a molecular weight of 306.27 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-[[(1R,4R,5R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-[[(1R,4R,5R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 147292670 |
| Molecular Formula | C12H18O9 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-[[(1R,4R,5R)-3,8,9-trioxatricyclo[4.2.1.02,4]nonan-5-yl]oxy]oxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](O[C@@H]2C3CO[C@H](O3)C3O[C@@H]32)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H18O9/c13-1-3-5(14)6(15)7(16)11(18-3)21-8-4-2-17-12(19-4)10-9(8)20-10/h3-16H,1-2H2/t3?,4?,5-,6?,7?,8-,9-,10?,11+,12-/m1/s1 |
| InChIKey | CUMRMKXAXIEPPL-SSBUPZPPSA-N |
| XLogP | -3.31 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|