C22H28O10 — CID 10072553
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1R,2S,6S,7R,8R)-4-phenyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-4-prop-2-enoxyoxane-3,5-diol (PubChem CID 10072553) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1R,2S,6S,7R,8R)-4-phenyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-4-prop-2-enoxyoxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1R,2S,6S,7R,8R)-4-phenyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-4-prop-2-enoxyoxane-3,5-diol |
|---|---|
| PubChem CID | 10072553 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(1R,2S,6S,7R,8R)-4-phenyl-3,5,10,11-tetraoxatricyclo[6.2.1.02,6]undecan-7-yl]oxy]-4-prop-2-enoxyoxane-3,5-diol |
| SMILES | C=CCO[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]2[C@@H]3OC(c4ccccc4)O[C@@H]3[C@@H]3OC[C@H]2O3)[C@@H]1O |
| InChI | InChI=1S/C22H28O10/c1-2-8-26-17-14(24)12(9-23)28-21(15(17)25)30-16-13-10-27-22(29-13)19-18(16)31-20(32-19)11-6-4-3-5-7-11/h2-7,12-25H,1,8-10H2/t12-,13-,14+,15-,16-,17+,18+,19+,20?,21+,22-/m1/s1 |
| InChIKey | URWIICKTFFSSQX-NLRXYDOASA-N |
| XLogP | -0.38 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|