C19H28N2O14S2 — CID 44604645
[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,2S,3R,4R,5R)-3-phenylmethoxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]oxan-3-yl]sulfamic acid (PubChem CID 44604645) has the molecular formula C19H28N2O14S2 and a molecular weight of 572.57 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,2S,3R,4R,5R)-3-phenylmethoxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]oxan-3-yl]sulfamic acid.
| Compound Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,2S,3R,4R,5R)-3-phenylmethoxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]oxan-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 44604645 |
| Molecular Formula | C19H28N2O14S2 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,2S,3R,4R,5R)-3-phenylmethoxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]oxan-3-yl]sulfamic acid |
| SMILES | O=S(=O)(O)N[C@H]1[C@@H](O[C@H]2[C@H](OCc3ccccc3)[C@@H](NS(=O)(=O)O)[C@@H]3OC[C@H]2O3)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H28N2O14S2/c22-6-10-14(23)15(24)12(20-36(25,26)27)19(33-10)35-16-11-8-32-18(34-11)13(21-37(28,29)30)17(16)31-7-9-4-2-1-3-5-9/h1-5,10-24H,6-8H2,(H,25,26,27)(H,28,29,30)/t10-,11-,12-,13-,14-,15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | WOLZVAUXWQEJGT-DEIGWAEKSA-N |
| XLogP | -3.33 |
| TPSA | 239.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|