About nickel;2-(oxaziridin-3-yl)phenol
nickel;2-(oxaziridin-3-yl)phenol (PubChem CID 174498524) has the molecular formula C7H7NNiO2
and a molecular weight of 195.83 g/mol. Its IUPAC name is nickel;2-(oxaziridin-3-yl)phenol.
Molecular Properties
| Compound Name | nickel;2-(oxaziridin-3-yl)phenol |
| PubChem CID | 174498524 |
| Molecular Formula | C7H7NNiO2 |
| Molecular Weight | 195.83 g/mol |
| Exact Mass | 194.98 |
| IUPAC Name | nickel;2-(oxaziridin-3-yl)phenol |
| SMILES | Oc1ccccc1C1NO1.[Ni] |
| InChI | InChI=1S/C7H7NO2.Ni/c9-6-4-2-1-3-5(6)7-8-10-7;/h1-4,7-9H; |
| InChIKey | POLSGDKQLMZOGU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.83 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze nickel;2-(oxaziridin-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;2-(oxaziridin-3-yl)phenol?
The IUPAC name of nickel;2-(oxaziridin-3-yl)phenol (CID 174498524) is nickel;2-(oxaziridin-3-yl)phenol.
What is the SMILES notation for nickel;2-(oxaziridin-3-yl)phenol?
The canonical SMILES for nickel;2-(oxaziridin-3-yl)phenol is Oc1ccccc1C1NO1.[Ni].
What is the InChIKey of nickel;2-(oxaziridin-3-yl)phenol?
The InChIKey is POLSGDKQLMZOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.Ni/c9-6-4-2-1-3-5(6)7-8-10-7;/h1-4,7-9H;.
What are the key properties of nickel;2-(oxaziridin-3-yl)phenol?
nickel;2-(oxaziridin-3-yl)phenol has a molecular weight of 195.83 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;2-(oxaziridin-3-yl)phenol is sourced from PubChem (CID 174498524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).