C9H10N2O2 — CID 146018572
2-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenol (PubChem CID 146018572) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenol.
| Compound Name | 2-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenol |
|---|---|
| PubChem CID | 146018572 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-(5-methyl-2,3-dihydro-1,3,4-oxadiazol-2-yl)phenol |
| SMILES | CC1=NNC(c2ccccc2O)O1 |
| InChI | InChI=1S/C9H10N2O2/c1-6-10-11-9(13-6)7-4-2-3-5-8(7)12/h2-5,9,11-12H,1H3 |
| InChIKey | CLZZQGDYYNSHND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|