C33H37NO2S2Si — CID 173425467
1-tert-butyl-3-dimethylsilyl-3-[hydroxy(thiophen-2-yl)methyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 173425467) has the molecular formula C33H37NO2S2Si and a molecular weight of 571.88 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(thiophen-2-yl)methyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(thiophen-2-yl)methyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173425467 |
| Molecular Formula | C33H37NO2S2Si |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-[hydroxy(thiophen-2-yl)methyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | C[SiH](C)C1(C(O)c2cccs2)C(=O)N(C(C)(C)C)C1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H37NO2S2Si/c1-31(2,3)34-29(36)33(39(4)5,28(35)27-22-15-23-37-27)30(34)38-32(24-16-9-6-10-17-24,25-18-11-7-12-19-25)26-20-13-8-14-21-26/h6-23,28,30,35,39H,1-5H3 |
| InChIKey | IZBNKPGBIPSNSM-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|