About cumene;3-propan-2-yl-1,2-oxazole
cumene;3-propan-2-yl-1,2-oxazole (PubChem CID 164964210) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is cumene;3-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | cumene;3-propan-2-yl-1,2-oxazole |
| PubChem CID | 164964210 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | cumene;3-propan-2-yl-1,2-oxazole |
| SMILES | CC(C)c1ccccc1.CC(C)c1ccon1 |
| InChI | InChI=1S/C9H12.C6H9NO/c1-8(2)9-6-4-3-5-7-9;1-5(2)6-3-4-8-7-6/h3-8H,1-2H3;3-5H,1-2H3 |
| InChIKey | CGEXTKJDLJUVSA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cumene;3-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;3-propan-2-yl-1,2-oxazole?
The IUPAC name of cumene;3-propan-2-yl-1,2-oxazole (CID 164964210) is cumene;3-propan-2-yl-1,2-oxazole.
What is the SMILES notation for cumene;3-propan-2-yl-1,2-oxazole?
The canonical SMILES for cumene;3-propan-2-yl-1,2-oxazole is CC(C)c1ccccc1.CC(C)c1ccon1.
What is the InChIKey of cumene;3-propan-2-yl-1,2-oxazole?
The InChIKey is CGEXTKJDLJUVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H9NO/c1-8(2)9-6-4-3-5-7-9;1-5(2)6-3-4-8-7-6/h3-8H,1-2H3;3-5H,1-2H3.
What are the key properties of cumene;3-propan-2-yl-1,2-oxazole?
cumene;3-propan-2-yl-1,2-oxazole has a molecular weight of 231.34 g/mol, XLogP of 4.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;3-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 164964210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).