C33H37N3O2SSi — CID 173367563
1-tert-butyl-3-dimethylsilyl-3-(1-methylpyrazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one (PubChem CID 173367563) has the molecular formula C33H37N3O2SSi and a molecular weight of 567.83 g/mol. Its IUPAC name is 1-tert-butyl-3-dimethylsilyl-3-(1-methylpyrazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one.
| Compound Name | 1-tert-butyl-3-dimethylsilyl-3-(1-methylpyrazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 173367563 |
| Molecular Formula | C33H37N3O2SSi |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 1-tert-butyl-3-dimethylsilyl-3-(1-methylpyrazole-3-carbonyl)-4-tritylsulfanylazetidin-2-one |
| SMILES | Cn1ccc(C(=O)C2([SiH](C)C)C(=O)N(C(C)(C)C)C2SC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C33H37N3O2SSi/c1-31(2,3)36-29(38)33(40(5)6,28(37)27-22-23-35(4)34-27)30(36)39-32(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-23,30,40H,1-6H3 |
| InChIKey | GAWHLCCTKDWMNJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|