C5H7N3O — CID 13464586
1-methylpyrazole-3-carboxamide (PubChem CID 13464586) has the molecular formula C5H7N3O and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-methylpyrazole-3-carboxamide.
| Compound Name | 1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 13464586 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(N)=O)n1 |
| InChI | InChI=1S/C5H7N3O/c1-8-3-2-4(7-8)5(6)9/h2-3H,1H3,(H2,6,9) |
| InChIKey | DBSMXZFYDNXILM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |