C7H10N4OS — CID 103117884
N-(2-amino-2-sulfanylideneethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103117884) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103117884 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NCC(N)=S)n1 |
| InChI | InChI=1S/C7H10N4OS/c1-11-3-2-5(10-11)7(12)9-4-6(8)13/h2-3H,4H2,1H3,(H2,8,13)(H,9,12) |
| InChIKey | ARALOAQNUYVCCJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|