C8H10N4O — CID 103117795
N-(2-cyanoethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103117795) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is N-(2-cyanoethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103117795 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-(2-cyanoethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NCCC#N)n1 |
| InChI | InChI=1S/C8H10N4O/c1-12-6-3-7(11-12)8(13)10-5-2-4-9/h3,6H,2,5H2,1H3,(H,10,13) |
| InChIKey | IDGGAWVUSBHBQP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|