C13H12N4O — CID 113230498
N-[4-(cyanomethyl)phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 113230498) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 113230498 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2ccc(CC#N)cc2)n1 |
| InChI | InChI=1S/C13H12N4O/c1-17-9-7-12(16-17)13(18)15-11-4-2-10(3-5-11)6-8-14/h2-5,7,9H,6H2,1H3,(H,15,18) |
| InChIKey | XKCNPQKORBSDNU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |