C9H15N3O3 — CID 103915328
N,N-bis(2-hydroxyethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103915328) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103915328 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)N(CCO)CCO)n1 |
| InChI | InChI=1S/C9H15N3O3/c1-11-3-2-8(10-11)9(15)12(4-6-13)5-7-14/h2-3,13-14H,4-7H2,1H3 |
| InChIKey | TWUNEGYNQYPGGY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |