C14H18N4O3 — CID 61115162
1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)pyrazole-3-carboxamide (PubChem CID 61115162) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 61115162 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)pyrazole-3-carboxamide |
| SMILES | Nc1ccc(-n2ccc(C(=O)N(CCO)CCO)n2)cc1 |
| InChI | InChI=1S/C14H18N4O3/c15-11-1-3-12(4-2-11)18-6-5-13(16-18)14(21)17(7-9-19)8-10-20/h1-6,19-20H,7-10,15H2 |
| InChIKey | KFDCABOZKPMKQD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|