C14H16N4O3 — CID 61315652
(3-amino-2-methyl-3-oxopropyl) 1-(4-aminophenyl)pyrazole-3-carboxylate (PubChem CID 61315652) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3-amino-2-methyl-3-oxopropyl) 1-(4-aminophenyl)pyrazole-3-carboxylate.
| Compound Name | (3-amino-2-methyl-3-oxopropyl) 1-(4-aminophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 61315652 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (3-amino-2-methyl-3-oxopropyl) 1-(4-aminophenyl)pyrazole-3-carboxylate |
| SMILES | CC(COC(=O)c1ccn(-c2ccc(N)cc2)n1)C(N)=O |
| InChI | InChI=1S/C14H16N4O3/c1-9(13(16)19)8-21-14(20)12-6-7-18(17-12)11-4-2-10(15)3-5-11/h2-7,9H,8,15H2,1H3,(H2,16,19) |
| InChIKey | PRSKKDNOTODNJV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|