About oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate
oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate (PubChem CID 115669822) has the molecular formula C13H13N3O3
and a molecular weight of 259.26 g/mol. Its IUPAC name is oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate |
| PubChem CID | 115669822 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate |
| SMILES | Nc1ccc(-n2ccc(C(=O)OC3COC3)n2)cc1 |
| InChI | InChI=1S/C13H13N3O3/c14-9-1-3-10(4-2-9)16-6-5-12(15-16)13(17)19-11-7-18-8-11/h1-6,11H,7-8,14H2 |
| InChIKey | ZJZAIQWJVGCNRF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate?
The IUPAC name of oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate (CID 115669822) is oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate.
What is the SMILES notation for oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate?
The canonical SMILES for oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate is Nc1ccc(-n2ccc(C(=O)OC3COC3)n2)cc1.
What is the InChIKey of oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate?
The InChIKey is ZJZAIQWJVGCNRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3/c14-9-1-3-10(4-2-9)16-6-5-12(15-16)13(17)19-11-7-18-8-11/h1-6,11H,7-8,14H2.
What are the key properties of oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate?
oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate has a molecular weight of 259.26 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 1-(4-aminophenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 115669822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).