C14H15N3O2 — CID 62383833
cyclobutyl 1-(3-aminophenyl)pyrazole-3-carboxylate (PubChem CID 62383833) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is cyclobutyl 1-(3-aminophenyl)pyrazole-3-carboxylate.
| Compound Name | cyclobutyl 1-(3-aminophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 62383833 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | cyclobutyl 1-(3-aminophenyl)pyrazole-3-carboxylate |
| SMILES | Nc1cccc(-n2ccc(C(=O)OC3CCC3)n2)c1 |
| InChI | InChI=1S/C14H15N3O2/c15-10-3-1-4-11(9-10)17-8-7-13(16-17)14(18)19-12-5-2-6-12/h1,3-4,7-9,12H,2,5-6,15H2 |
| InChIKey | BQJHHTRHRNEAGK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|