C13H16N4O3 — CID 65310413
1-(3-aminophenyl)-N-(1,3-dihydroxypropan-2-yl)pyrazole-3-carboxamide (PubChem CID 65310413) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-(1,3-dihydroxypropan-2-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(3-aminophenyl)-N-(1,3-dihydroxypropan-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65310413 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(3-aminophenyl)-N-(1,3-dihydroxypropan-2-yl)pyrazole-3-carboxamide |
| SMILES | Nc1cccc(-n2ccc(C(=O)NC(CO)CO)n2)c1 |
| InChI | InChI=1S/C13H16N4O3/c14-9-2-1-3-11(6-9)17-5-4-12(16-17)13(20)15-10(7-18)8-19/h1-6,10,18-19H,7-8,14H2,(H,15,20) |
| InChIKey | GTXYZZKXHGVZCG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|