About cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate
cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate (PubChem CID 106930469) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate |
| PubChem CID | 106930469 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate |
| SMILES | Nc1cccc(-n2ccc(C(=O)OCOCC3CC3)n2)c1 |
| InChI | InChI=1S/C15H17N3O3/c16-12-2-1-3-13(8-12)18-7-6-14(17-18)15(19)21-10-20-9-11-4-5-11/h1-3,6-8,11H,4-5,9-10,16H2 |
| InChIKey | KOSFEJYBQIUFKL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The IUPAC name of cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate (CID 106930469) is cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate.
What is the SMILES notation for cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The canonical SMILES for cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate is Nc1cccc(-n2ccc(C(=O)OCOCC3CC3)n2)c1.
What is the InChIKey of cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The InChIKey is KOSFEJYBQIUFKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c16-12-2-1-3-13(8-12)18-7-6-14(17-18)15(19)21-10-20-9-11-4-5-11/h1-3,6-8,11H,4-5,9-10,16H2.
What are the key properties of cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate?
cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate has a molecular weight of 287.32 g/mol, XLogP of 2.00, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethoxymethyl 1-(3-aminophenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 106930469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).