About pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate
pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate (PubChem CID 102983084) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate |
| PubChem CID | 102983084 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate |
| SMILES | CCCC(C)OC(=O)c1ccn(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C15H19N3O2/c1-3-5-11(2)20-15(19)14-8-9-18(17-14)13-7-4-6-12(16)10-13/h4,6-11H,3,5,16H2,1-2H3 |
| InChIKey | LQFUDECSYZTHGB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The IUPAC name of pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate (CID 102983084) is pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate.
What is the SMILES notation for pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The canonical SMILES for pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate is CCCC(C)OC(=O)c1ccn(-c2cccc(N)c2)n1.
What is the InChIKey of pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate?
The InChIKey is LQFUDECSYZTHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-3-5-11(2)20-15(19)14-8-9-18(17-14)13-7-4-6-12(16)10-13/h4,6-11H,3,5,16H2,1-2H3.
What are the key properties of pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate?
pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate has a molecular weight of 273.34 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 1-(3-aminophenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 102983084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).