C13H11N5OS — CID 43475407
1-(3-aminophenyl)-N-(1,3-thiazol-2-yl)pyrazole-3-carboxamide (PubChem CID 43475407) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N-(1,3-thiazol-2-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(3-aminophenyl)-N-(1,3-thiazol-2-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 43475407 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-(3-aminophenyl)-N-(1,3-thiazol-2-yl)pyrazole-3-carboxamide |
| SMILES | Nc1cccc(-n2ccc(C(=O)Nc3nccs3)n2)c1 |
| InChI | InChI=1S/C13H11N5OS/c14-9-2-1-3-10(8-9)18-6-4-11(17-18)12(19)16-13-15-5-7-20-13/h1-8H,14H2,(H,15,16,19) |
| InChIKey | ZWBDBPLYDSZVIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|