C16H29NO4SSi — CID 141320936
S-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate (PubChem CID 141320936) has the molecular formula C16H29NO4SSi and a molecular weight of 359.56 g/mol. Its IUPAC name is S-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate.
| Compound Name | S-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate |
|---|---|
| PubChem CID | 141320936 |
| Molecular Formula | C16H29NO4SSi |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | S-[(2R,3R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N[C@@H]1SC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C16H29NO4SSi/c1-10(21-23(5,6)16(2,3)4)12-13(18)17-14(12)22-15(19)11-8-7-9-20-11/h10-12,14H,7-9H2,1-6H3,(H,17,18)/t10-,11-,12-,14-/m1/s1 |
| InChIKey | CYIYODQQOPTSEF-HKUMRIAESA-N |
| XLogP | 2.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|