C17H31N5O3S2Si — CID 56625439
S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-(1-methyltetrazol-5-yl)sulfanylbutanethioate (PubChem CID 56625439) has the molecular formula C17H31N5O3S2Si and a molecular weight of 445.69 g/mol. Its IUPAC name is S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-(1-methyltetrazol-5-yl)sulfanylbutanethioate.
| Compound Name | S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-(1-methyltetrazol-5-yl)sulfanylbutanethioate |
|---|---|
| PubChem CID | 56625439 |
| Molecular Formula | C17H31N5O3S2Si |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-(1-methyltetrazol-5-yl)sulfanylbutanethioate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1SC(=O)CCCSc1nnnn1C |
| InChI | InChI=1S/C17H31N5O3S2Si/c1-11(25-28(6,7)17(2,3)4)13-14(24)18-15(13)27-12(23)9-8-10-26-16-19-20-21-22(16)5/h11,13,15H,8-10H2,1-7H3,(H,18,24)/t11-,13+,15-/m1/s1 |
| InChIKey | HFQALPUOGCDOET-OSAQELSMSA-N |
| XLogP | 2.82 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|