C17H17N7O6 — CID 155099635
(4-nitrophenyl)methyl 4-[3-(1-azidoethyl)-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate (PubChem CID 155099635) has the molecular formula C17H17N7O6 and a molecular weight of 415.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[3-(1-azidoethyl)-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 4-[3-(1-azidoethyl)-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate |
|---|---|
| PubChem CID | 155099635 |
| Molecular Formula | C17H17N7O6 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[3-(1-azidoethyl)-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate |
| SMILES | CC(N=[N+]=[N-])C1C(=O)NC1C(C)C(=O)C(=[N+]=[N-])C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N7O6/c1-8(13-12(16(26)20-13)9(2)22-23-19)15(25)14(21-18)17(27)30-7-10-3-5-11(6-4-10)24(28)29/h3-6,8-9,12-13H,7H2,1-2H3,(H,20,26) |
| InChIKey | OCZPTRFLGDHXPY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 200.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|