C22H30N6O5Si — CID 162454204
(4-azidophenyl)methyl 2-diazo-3-oxo-4-[(2R,3S)-4-oxo-3-[(1R)-1-triethylsilyloxyethyl]azetidin-2-yl]butanoate (PubChem CID 162454204) has the molecular formula C22H30N6O5Si and a molecular weight of 486.61 g/mol. Its IUPAC name is (4-azidophenyl)methyl 2-diazo-3-oxo-4-[(2R,3S)-4-oxo-3-[(1R)-1-triethylsilyloxyethyl]azetidin-2-yl]butanoate.
| Compound Name | (4-azidophenyl)methyl 2-diazo-3-oxo-4-[(2R,3S)-4-oxo-3-[(1R)-1-triethylsilyloxyethyl]azetidin-2-yl]butanoate |
|---|---|
| PubChem CID | 162454204 |
| Molecular Formula | C22H30N6O5Si |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (4-azidophenyl)methyl 2-diazo-3-oxo-4-[(2R,3S)-4-oxo-3-[(1R)-1-triethylsilyloxyethyl]azetidin-2-yl]butanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@H]1C(=O)N[C@@H]1CC(=O)C(=[N+]=[N-])C(=O)OCc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C22H30N6O5Si/c1-5-34(6-2,7-3)33-14(4)19-17(25-21(19)30)12-18(29)20(26-23)22(31)32-13-15-8-10-16(11-9-15)27-28-24/h8-11,14,17,19H,5-7,12-13H2,1-4H3,(H,25,30)/t14-,17-,19-/m1/s1 |
| InChIKey | IQQOXNHIFQVVIU-LSBZLQRGSA-N |
| XLogP | 3.83 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|