C17H18N4O8 — CID 171768155
[(4R)-2-diazo-4-[(2S,3S)-4-hydroxy-3-[(1R)-1-hydroxyethyl]azetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate (PubChem CID 171768155) has the molecular formula C17H18N4O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is [(4R)-2-diazo-4-[(2S,3S)-4-hydroxy-3-[(1R)-1-hydroxyethyl]azetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate.
| Compound Name | [(4R)-2-diazo-4-[(2S,3S)-4-hydroxy-3-[(1R)-1-hydroxyethyl]azetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 171768155 |
| Molecular Formula | C17H18N4O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [(4R)-2-diazo-4-[(2S,3S)-4-hydroxy-3-[(1R)-1-hydroxyethyl]azetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate |
| SMILES | C[C@@H](O)[C@H]1C(O)N[C@@H]1[C@@H](C)C(=O)C(=[N+]=[N-])C(=O)OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N4O8/c1-7(12-11(8(2)22)15(24)19-12)14(23)13(20-18)17(26)29-16(25)9-3-5-10(6-4-9)21(27)28/h3-8,11-12,15,19,22,24H,1-2H3/t7-,8-,11-,12-,15?/m1/s1 |
| InChIKey | SIBRVYNNHCXPJJ-MNQJGZSWSA-N |
| XLogP | -0.56 |
| TPSA | 192.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|