C17H18N4O7 — CID 155229423
2-diazo-4-[3-(1-hydroxyethyl)-2-methyl-4-oxoazetidin-2-yl]-5-(4-nitrophenyl)-3-oxopentanoic acid (PubChem CID 155229423) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is 2-diazo-4-[3-(1-hydroxyethyl)-2-methyl-4-oxoazetidin-2-yl]-5-(4-nitrophenyl)-3-oxopentanoic acid.
| Compound Name | 2-diazo-4-[3-(1-hydroxyethyl)-2-methyl-4-oxoazetidin-2-yl]-5-(4-nitrophenyl)-3-oxopentanoic acid |
|---|---|
| PubChem CID | 155229423 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-diazo-4-[3-(1-hydroxyethyl)-2-methyl-4-oxoazetidin-2-yl]-5-(4-nitrophenyl)-3-oxopentanoic acid |
| SMILES | CC(O)C1C(=O)NC1(C)C(Cc1ccc([N+](=O)[O-])cc1)C(=O)C(=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C17H18N4O7/c1-8(22)12-15(24)19-17(12,2)11(14(23)13(20-18)16(25)26)7-9-3-5-10(6-4-9)21(27)28/h3-6,8,11-12,22H,7H2,1-2H3,(H,19,24)(H,25,26) |
| InChIKey | GPRXIHHHRZSZKZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|