C25H23BrN4O7S — CID 58521574
(4-nitrophenyl)methyl (5R)-6-[acetyloxy-(3-methyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 58521574) has the molecular formula C25H23BrN4O7S and a molecular weight of 603.45 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(3-methyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(3-methyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 58521574 |
| Molecular Formula | C25H23BrN4O7S |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(3-methyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(c1nn(C)c2c1C1CCC2C1)C1(Br)C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@@H]21 |
| InChI | InChI=1S/C25H23BrN4O7S/c1-12(31)37-21(19-18-14-5-6-15(9-14)20(18)28(2)27-19)25(26)23(33)29-17(11-38-24(25)29)22(32)36-10-13-3-7-16(8-4-13)30(34)35/h3-4,7-8,11,14-15,21,24H,5-6,9-10H2,1-2H3/t14?,15?,21?,24-,25?/m1/s1 |
| InChIKey | BEEYBIOPWTVBSC-VQBABUJSSA-N |
| XLogP | 3.93 |
| TPSA | 133.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|