C22H17BrN4O9S — CID 86591431
(4-nitrophenyl)methyl (5R)-6-[acetyloxy-(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 86591431) has the molecular formula C22H17BrN4O9S and a molecular weight of 593.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 86591431 |
| Molecular Formula | C22H17BrN4O9S |
| Molecular Weight | 593.37 g/mol |
| Exact Mass | 591.99 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(4-oxo-6,7-dihydropyrazolo[5,1-c][1,4]oxazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(c1cc2n(n1)CCOC2=O)C1(Br)C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@@H]21 |
| InChI | InChI=1S/C22H17BrN4O9S/c1-11(28)36-17(14-8-15-18(29)34-7-6-25(15)24-14)22(23)20(31)26-16(10-37-21(22)26)19(30)35-9-12-2-4-13(5-3-12)27(32)33/h2-5,8,10,17,21H,6-7,9H2,1H3/t17?,21-,22?/m1/s1 |
| InChIKey | FODPPWQYZITQNA-PDRFFQIWSA-N |
| XLogP | 2.20 |
| TPSA | 160.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|