C24H20N4O6S2 — CID 22828889
(4-nitrophenyl)methyl (6S)-7-[[2-(1-benzothiophen-3-ylamino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22828889) has the molecular formula C24H20N4O6S2 and a molecular weight of 524.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[[2-(1-benzothiophen-3-ylamino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[[2-(1-benzothiophen-3-ylamino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22828889 |
| Molecular Formula | C24H20N4O6S2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[[2-(1-benzothiophen-3-ylamino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(CNc1csc2ccccc12)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@@H]12 |
| InChI | InChI=1S/C24H20N4O6S2/c29-20(11-25-17-13-36-19-4-2-1-3-16(17)19)26-21-22(30)27-18(9-10-35-23(21)27)24(31)34-12-14-5-7-15(8-6-14)28(32)33/h1-9,13,21,23,25H,10-12H2,(H,26,29)/t21?,23-/m0/s1 |
| InChIKey | FTUDXRQRXQKRDS-YANBTOMASA-N |
| XLogP | 3.25 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|