C19H23N3O6S2 — CID 88605469
(4-nitrophenyl)methyl (5R)-3-(2-acetamidoethylsulfanyl)-6-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 88605469) has the molecular formula C19H23N3O6S2 and a molecular weight of 453.54 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3-(2-acetamidoethylsulfanyl)-6-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3-(2-acetamidoethylsulfanyl)-6-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 88605469 |
| Molecular Formula | C19H23N3O6S2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3-(2-acetamidoethylsulfanyl)-6-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | CCC1C(=O)N2CC(SCCNC(C)=O)(C(=O)OCc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C19H23N3O6S2/c1-3-15-16(24)21-11-19(30-17(15)21,29-9-8-20-12(2)23)18(25)28-10-13-4-6-14(7-5-13)22(26)27/h4-7,15,17H,3,8-11H2,1-2H3,(H,20,23)/t15?,17-,19?/m1/s1 |
| InChIKey | CTIUYJQCUMOCDB-URSIVYNOSA-N |
| XLogP | 2.14 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|