C29H25N3O8S2 — CID 134990763
(4-nitrophenyl)methyl (2S,5R,6S)-6-methoxy-3,3-dimethyl-7-oxo-6-[(3-oxo-3-phenoxy-2-thiophen-3-ylprop-1-enylidene)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 134990763) has the molecular formula C29H25N3O8S2 and a molecular weight of 607.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,5R,6S)-6-methoxy-3,3-dimethyl-7-oxo-6-[(3-oxo-3-phenoxy-2-thiophen-3-ylprop-1-enylidene)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,5R,6S)-6-methoxy-3,3-dimethyl-7-oxo-6-[(3-oxo-3-phenoxy-2-thiophen-3-ylprop-1-enylidene)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 134990763 |
| Molecular Formula | C29H25N3O8S2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,5R,6S)-6-methoxy-3,3-dimethyl-7-oxo-6-[(3-oxo-3-phenoxy-2-thiophen-3-ylprop-1-enylidene)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CO[C@@]1(N=C=C(C(=O)Oc2ccccc2)c2ccsc2)C(=O)N2[C@@H](C(=O)OCc3ccc([N+](=O)[O-])cc3)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C29H25N3O8S2/c1-28(2)23(25(34)39-16-18-9-11-20(12-10-18)32(36)37)31-26(35)29(38-3,27(31)42-28)30-15-22(19-13-14-41-17-19)24(33)40-21-7-5-4-6-8-21/h4-14,17,23,27H,16H2,1-3H3/t23-,27+,29-/m0/s1 |
| InChIKey | HZIMBSIMINTXEK-LCRMXPIESA-N |
| XLogP | 4.46 |
| TPSA | 137.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|