C12H14N2O4S — CID 82921954
2-(2-methyl-4-sulfamoylphenoxy)-N-prop-2-ynylacetamide (PubChem CID 82921954) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(2-methyl-4-sulfamoylphenoxy)-N-prop-2-ynylacetamide.
| Compound Name | 2-(2-methyl-4-sulfamoylphenoxy)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 82921954 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(2-methyl-4-sulfamoylphenoxy)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COc1ccc(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C12H14N2O4S/c1-3-6-14-12(15)8-18-11-5-4-10(7-9(11)2)19(13,16)17/h1,4-5,7H,6,8H2,2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | BERPTZMKAWGNQG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|