C20H17F2NO3S — CID 67654311
2-[4,5-difluoro-2-(4-methoxy-3-methylphenyl)phenyl]benzenesulfonamide (PubChem CID 67654311) has the molecular formula C20H17F2NO3S and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[4,5-difluoro-2-(4-methoxy-3-methylphenyl)phenyl]benzenesulfonamide.
| Compound Name | 2-[4,5-difluoro-2-(4-methoxy-3-methylphenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67654311 |
| Molecular Formula | C20H17F2NO3S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[4,5-difluoro-2-(4-methoxy-3-methylphenyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(F)c(F)cc2-c2ccccc2S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C20H17F2NO3S/c1-12-9-13(7-8-19(12)26-2)15-10-17(21)18(22)11-16(15)14-5-3-4-6-20(14)27(23,24)25/h3-11H,1-2H3,(H2,23,24,25) |
| InChIKey | JFUZMIMGPSBGLQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |