C20H16ClNO4S — CID 67654916
2-[6-(4-chloro-3-methylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 67654916) has the molecular formula C20H16ClNO4S and a molecular weight of 401.87 g/mol. Its IUPAC name is 2-[6-(4-chloro-3-methylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 2-[6-(4-chloro-3-methylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67654916 |
| Molecular Formula | C20H16ClNO4S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 2-[6-(4-chloro-3-methylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | Cc1cc(-c2cc3c(cc2-c2ccccc2S(N)(=O)=O)OCO3)ccc1Cl |
| InChI | InChI=1S/C20H16ClNO4S/c1-12-8-13(6-7-17(12)21)15-9-18-19(26-11-25-18)10-16(15)14-4-2-3-5-20(14)27(22,23)24/h2-10H,11H2,1H3,(H2,22,23,24) |
| InChIKey | HULFPTHQAWBCAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |