C21H19NO4S — CID 67654177
2-[6-(3,4-dimethylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 67654177) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[6-(3,4-dimethylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 2-[6-(3,4-dimethylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67654177 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[6-(3,4-dimethylphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc3c(cc2-c2ccccc2S(N)(=O)=O)OCO3)cc1C |
| InChI | InChI=1S/C21H19NO4S/c1-13-7-8-15(9-14(13)2)17-10-19-20(26-12-25-19)11-18(17)16-5-3-4-6-21(16)27(22,23)24/h3-11H,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | UGDWEFPLXFCOCW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |