C20H17F2NO4S — CID 10621294
4-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide (PubChem CID 10621294) has the molecular formula C20H17F2NO4S and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10621294 |
| Molecular Formula | C20H17F2NO4S |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)-4,5-difluorophenyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H17F2NO4S/c1-26-19-8-5-13(9-20(19)27-2)16-11-18(22)17(21)10-15(16)12-3-6-14(7-4-12)28(23,24)25/h3-11H,1-2H3,(H2,23,24,25) |
| InChIKey | DYBYPXGXLZNZQU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |