C13H11NO4S — CID 127025295
4-(1,3-benzodioxol-5-yl)benzenesulfonamide (PubChem CID 127025295) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)benzenesulfonamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 127025295 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C13H11NO4S/c14-19(15,16)11-4-1-9(2-5-11)10-3-6-12-13(7-10)18-8-17-12/h1-7H,8H2,(H2,14,15,16) |
| InChIKey | LXRKXXNMJMUGLG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |