C20H15Cl2NO5S — CID 67654511
2-[6-(3,5-dichloro-4-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 67654511) has the molecular formula C20H15Cl2NO5S and a molecular weight of 452.32 g/mol. Its IUPAC name is 2-[6-(3,5-dichloro-4-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 2-[6-(3,5-dichloro-4-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67654511 |
| Molecular Formula | C20H15Cl2NO5S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 2-[6-(3,5-dichloro-4-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | COc1c(Cl)cc(-c2cc3c(cc2-c2ccccc2S(N)(=O)=O)OCO3)cc1Cl |
| InChI | InChI=1S/C20H15Cl2NO5S/c1-26-20-15(21)6-11(7-16(20)22)13-8-17-18(28-10-27-17)9-14(13)12-4-2-3-5-19(12)29(23,24)25/h2-9H,10H2,1H3,(H2,23,24,25) |
| InChIKey | GVUQVVOSGIZPJI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |