C20H16FNO5S — CID 67653306
2-[6-(4-fluoro-3-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 67653306) has the molecular formula C20H16FNO5S and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-[6-(4-fluoro-3-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | 2-[6-(4-fluoro-3-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67653306 |
| Molecular Formula | C20H16FNO5S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[6-(4-fluoro-3-methoxyphenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | COc1cc(-c2cc3c(cc2-c2ccccc2S(N)(=O)=O)OCO3)ccc1F |
| InChI | InChI=1S/C20H16FNO5S/c1-25-17-8-12(6-7-16(17)21)14-9-18-19(27-11-26-18)10-15(14)13-4-2-3-5-20(13)28(22,23)24/h2-10H,11H2,1H3,(H2,22,23,24) |
| InChIKey | BETCDAOPEBIFLU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |